C17H18N4O3 — CID 177021405
7-amino-8-(5-hydroxycyclohexa-1,5-dien-1-yl)-1,3-dimethyl-2-oxoquinoxaline-6-carboxamide (PubChem CID 177021405) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is 7-amino-8-(5-hydroxycyclohexa-1,5-dien-1-yl)-1,3-dimethyl-2-oxoquinoxaline-6-carboxamide.
| Compound Name | 7-amino-8-(5-hydroxycyclohexa-1,5-dien-1-yl)-1,3-dimethyl-2-oxoquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 177021405 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 7-amino-8-(5-hydroxycyclohexa-1,5-dien-1-yl)-1,3-dimethyl-2-oxoquinoxaline-6-carboxamide |
| SMILES | Cc1nc2cc(C(N)=O)c(N)c(C3=CCCC(O)=C3)c2n(C)c1=O |
| InChI | InChI=1S/C17H18N4O3/c1-8-17(24)21(2)15-12(20-8)7-11(16(19)23)14(18)13(15)9-4-3-5-10(22)6-9/h4,6-7,22H,3,5,18H2,1-2H3,(H2,19,23) |
| InChIKey | RIRMEWRFUHUQPM-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 124.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|