About (4-methyl-1H-imidazo[4,5-c]pyridin-2-yl)methanol
(4-methyl-1H-imidazo[4,5-c]pyridin-2-yl)methanol (PubChem CID 177021910) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is (4-methyl-1H-imidazo[4,5-c]pyridin-2-yl)methanol.
Molecular Properties
| Compound Name | (4-methyl-1H-imidazo[4,5-c]pyridin-2-yl)methanol |
| PubChem CID | 177021910 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | (4-methyl-1H-imidazo[4,5-c]pyridin-2-yl)methanol |
| SMILES | Cc1nccc2[nH]c(CO)nc12 |
| InChI | InChI=1S/C8H9N3O/c1-5-8-6(2-3-9-5)10-7(4-12)11-8/h2-3,12H,4H2,1H3,(H,10,11) |
| InChIKey | OMAMETHBTLPGCF-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-methyl-1H-imidazo[4,5-c]pyridin-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-1H-imidazo[4,5-c]pyridin-2-yl)methanol?
The IUPAC name of (4-methyl-1H-imidazo[4,5-c]pyridin-2-yl)methanol (CID 177021910) is (4-methyl-1H-imidazo[4,5-c]pyridin-2-yl)methanol.
What is the SMILES notation for (4-methyl-1H-imidazo[4,5-c]pyridin-2-yl)methanol?
The canonical SMILES for (4-methyl-1H-imidazo[4,5-c]pyridin-2-yl)methanol is Cc1nccc2[nH]c(CO)nc12.
What is the InChIKey of (4-methyl-1H-imidazo[4,5-c]pyridin-2-yl)methanol?
The InChIKey is OMAMETHBTLPGCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O/c1-5-8-6(2-3-9-5)10-7(4-12)11-8/h2-3,12H,4H2,1H3,(H,10,11).
What are the key properties of (4-methyl-1H-imidazo[4,5-c]pyridin-2-yl)methanol?
(4-methyl-1H-imidazo[4,5-c]pyridin-2-yl)methanol has a molecular weight of 163.18 g/mol, XLogP of 0.76, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-1H-imidazo[4,5-c]pyridin-2-yl)methanol is sourced from PubChem (CID 177021910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).