C15H18N2 — CID 177022160
6-[(2E)-2-ethenylpenta-2,4-dienyl]-7,8-dihydro-5H-1,6-naphthyridine (PubChem CID 177022160) has the molecular formula C15H18N2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 6-[(2E)-2-ethenylpenta-2,4-dienyl]-7,8-dihydro-5H-1,6-naphthyridine.
| Compound Name | 6-[(2E)-2-ethenylpenta-2,4-dienyl]-7,8-dihydro-5H-1,6-naphthyridine |
|---|---|
| PubChem CID | 177022160 |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 6-[(2E)-2-ethenylpenta-2,4-dienyl]-7,8-dihydro-5H-1,6-naphthyridine |
| SMILES | C=C/C=C(\C=C)CN1CCc2ncccc2C1 |
| InChI | InChI=1S/C15H18N2/c1-3-6-13(4-2)11-17-10-8-15-14(12-17)7-5-9-16-15/h3-7,9H,1-2,8,10-12H2/b13-6+ |
| InChIKey | XBGNFANQQQFXEP-AWNIVKPZSA-N |
| XLogP | 2.74 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|