About CID 177022453
CID 177022453 (PubChem CID 177022453) has the molecular formula C10H9BN2O
and a molecular weight of 184.01 g/mol.
Molecular Properties
| Compound Name | CID 177022453 |
| PubChem CID | 177022453 |
| Molecular Formula | C10H9BN2O |
| Molecular Weight | 184.01 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | — |
| SMILES | [B]Cc1cnc2cc(C)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C10H9BN2O/c1-6-2-8-9(13-10(6)14)3-7(4-11)5-12-8/h2-3,5H,4H2,1H3,(H,13,14) |
| InChIKey | JAVLSHRFCJXXIG-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.01 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 177022453 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177022453?
The IUPAC name of CID 177022453 (CID 177022453) is not available.
What is the SMILES notation for CID 177022453?
The canonical SMILES for CID 177022453 is [B]Cc1cnc2cc(C)c(=O)[nH]c2c1.
What is the InChIKey of CID 177022453?
The InChIKey is JAVLSHRFCJXXIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BN2O/c1-6-2-8-9(13-10(6)14)3-7(4-11)5-12-8/h2-3,5H,4H2,1H3,(H,13,14).
What are the key properties of CID 177022453?
CID 177022453 has a molecular weight of 184.01 g/mol, XLogP of 0.90, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177022453 is sourced from PubChem (CID 177022453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).