C23H27FN6O2 — CID 177023014
acetonitrile;2-fluoroprop-2-enal;2-[6-[(4-methylpiperazin-1-yl)methyl]-7H-pyrrolo[2,3-c]pyridazin-3-yl]phenol (PubChem CID 177023014) has the molecular formula C23H27FN6O2 and a molecular weight of 438.51 g/mol. Its IUPAC name is acetonitrile;2-fluoroprop-2-enal;2-[6-[(4-methylpiperazin-1-yl)methyl]-7H-pyrrolo[2,3-c]pyridazin-3-yl]phenol.
| Compound Name | acetonitrile;2-fluoroprop-2-enal;2-[6-[(4-methylpiperazin-1-yl)methyl]-7H-pyrrolo[2,3-c]pyridazin-3-yl]phenol |
|---|---|
| PubChem CID | 177023014 |
| Molecular Formula | C23H27FN6O2 |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | acetonitrile;2-fluoroprop-2-enal;2-[6-[(4-methylpiperazin-1-yl)methyl]-7H-pyrrolo[2,3-c]pyridazin-3-yl]phenol |
| SMILES | C=C(F)C=O.CC#N.CN1CCN(Cc2cc3cc(-c4ccccc4O)nnc3[nH]2)CC1 |
| InChI | InChI=1S/C18H21N5O.C3H3FO.C2H3N/c1-22-6-8-23(9-7-22)12-14-10-13-11-16(20-21-18(13)19-14)15-4-2-3-5-17(15)24;1-3(4)2-5;1-2-3/h2-5,10-11,24H,6-9,12H2,1H3,(H,19,21);2H,1H2;1H3 |
| InChIKey | ORZFZUJMHYWOPD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|