C20H18F2N4O2 — CID 177023260
1-[4,4-difluoro-2-[3-(2-hydroxyphenyl)-7H-pyrrolo[2,3-c]pyridazin-6-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 177023260) has the molecular formula C20H18F2N4O2 and a molecular weight of 384.39 g/mol. Its IUPAC name is 1-[4,4-difluoro-2-[3-(2-hydroxyphenyl)-7H-pyrrolo[2,3-c]pyridazin-6-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4,4-difluoro-2-[3-(2-hydroxyphenyl)-7H-pyrrolo[2,3-c]pyridazin-6-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 177023260 |
| Molecular Formula | C20H18F2N4O2 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 1-[4,4-difluoro-2-[3-(2-hydroxyphenyl)-7H-pyrrolo[2,3-c]pyridazin-6-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(F)(F)CC1c1cc2cc(-c3ccccc3O)nnc2[nH]1 |
| InChI | InChI=1S/C20H18F2N4O2/c1-2-18(28)26-8-7-20(21,22)11-16(26)15-10-12-9-14(24-25-19(12)23-15)13-5-3-4-6-17(13)27/h2-6,9-10,16,27H,1,7-8,11H2,(H,23,25) |
| InChIKey | UGLHHPYONZSXIQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|