C25H28N4O3 — CID 177023273
1-[(1S)-6-azabicyclo[3.2.0]heptan-6-yl]prop-2-en-1-one;2-[5-(oxolan-3-yl)-7H-pyrrolo[2,3-c]pyridazin-3-yl]phenol (PubChem CID 177023273) has the molecular formula C25H28N4O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is 1-[(1S)-6-azabicyclo[3.2.0]heptan-6-yl]prop-2-en-1-one;2-[5-(oxolan-3-yl)-7H-pyrrolo[2,3-c]pyridazin-3-yl]phenol.
| Compound Name | 1-[(1S)-6-azabicyclo[3.2.0]heptan-6-yl]prop-2-en-1-one;2-[5-(oxolan-3-yl)-7H-pyrrolo[2,3-c]pyridazin-3-yl]phenol |
|---|---|
| PubChem CID | 177023273 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 1-[(1S)-6-azabicyclo[3.2.0]heptan-6-yl]prop-2-en-1-one;2-[5-(oxolan-3-yl)-7H-pyrrolo[2,3-c]pyridazin-3-yl]phenol |
| SMILES | C=CC(=O)N1C[C@@H]2CCCC21.Oc1ccccc1-c1cc2c(C3CCOC3)c[nH]c2nn1 |
| InChI | InChI=1S/C16H15N3O2.C9H13NO/c20-15-4-2-1-3-11(15)14-7-12-13(10-5-6-21-9-10)8-17-16(12)19-18-14;1-2-9(11)10-6-7-4-3-5-8(7)10/h1-4,7-8,10,20H,5-6,9H2,(H,17,19);2,7-8H,1,3-6H2/t;7-,8?/m.0/s1 |
| InChIKey | XATSIWZLTLLAIE-IAAPHERYSA-N |
| XLogP | 4.02 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|