C23H27FN4O3 — CID 177023763
1-(3-fluoropyrrolidin-1-yl)prop-2-en-1-one;2-[5-(3-methoxypropyl)-7H-pyrrolo[2,3-c]pyridazin-3-yl]phenol (PubChem CID 177023763) has the molecular formula C23H27FN4O3 and a molecular weight of 426.49 g/mol. Its IUPAC name is 1-(3-fluoropyrrolidin-1-yl)prop-2-en-1-one;2-[5-(3-methoxypropyl)-7H-pyrrolo[2,3-c]pyridazin-3-yl]phenol.
| Compound Name | 1-(3-fluoropyrrolidin-1-yl)prop-2-en-1-one;2-[5-(3-methoxypropyl)-7H-pyrrolo[2,3-c]pyridazin-3-yl]phenol |
|---|---|
| PubChem CID | 177023763 |
| Molecular Formula | C23H27FN4O3 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 1-(3-fluoropyrrolidin-1-yl)prop-2-en-1-one;2-[5-(3-methoxypropyl)-7H-pyrrolo[2,3-c]pyridazin-3-yl]phenol |
| SMILES | C=CC(=O)N1CCC(F)C1.COCCCc1c[nH]c2nnc(-c3ccccc3O)cc12 |
| InChI | InChI=1S/C16H17N3O2.C7H10FNO/c1-21-8-4-5-11-10-17-16-13(11)9-14(18-19-16)12-6-2-3-7-15(12)20;1-2-7(10)9-4-3-6(8)5-9/h2-3,6-7,9-10,20H,4-5,8H2,1H3,(H,17,19);2,6H,1,3-5H2 |
| InChIKey | SWMYZGXIMDYNLS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|