C23H25N5O3 — CID 177024010
4-[6-(1-formylazetidin-3-yl)-3-(2-hydroxyphenyl)-7H-pyrrolo[2,3-c]pyridazin-5-yl]cyclohexane-1-carboxamide (PubChem CID 177024010) has the molecular formula C23H25N5O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is 4-[6-(1-formylazetidin-3-yl)-3-(2-hydroxyphenyl)-7H-pyrrolo[2,3-c]pyridazin-5-yl]cyclohexane-1-carboxamide.
| Compound Name | 4-[6-(1-formylazetidin-3-yl)-3-(2-hydroxyphenyl)-7H-pyrrolo[2,3-c]pyridazin-5-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 177024010 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 4-[6-(1-formylazetidin-3-yl)-3-(2-hydroxyphenyl)-7H-pyrrolo[2,3-c]pyridazin-5-yl]cyclohexane-1-carboxamide |
| SMILES | NC(=O)C1CCC(c2c(C3CN(C=O)C3)[nH]c3nnc(-c4ccccc4O)cc23)CC1 |
| InChI | InChI=1S/C23H25N5O3/c24-22(31)14-7-5-13(6-8-14)20-17-9-18(16-3-1-2-4-19(16)30)26-27-23(17)25-21(20)15-10-28(11-15)12-29/h1-4,9,12-15,30H,5-8,10-11H2,(H2,24,31)(H,25,27) |
| InChIKey | LICKTRYOJANLMW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|