About 2-cyclopropyl-4-methoxy-3,6-dimethylpyridine;ethane
2-cyclopropyl-4-methoxy-3,6-dimethylpyridine;ethane (PubChem CID 177024398) has the molecular formula C13H21NO
and a molecular weight of 207.32 g/mol. Its IUPAC name is 2-cyclopropyl-4-methoxy-3,6-dimethylpyridine;ethane.
Molecular Properties
| Compound Name | 2-cyclopropyl-4-methoxy-3,6-dimethylpyridine;ethane |
| PubChem CID | 177024398 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 2-cyclopropyl-4-methoxy-3,6-dimethylpyridine;ethane |
| SMILES | CC.COc1cc(C)nc(C2CC2)c1C |
| InChI | InChI=1S/C11H15NO.C2H6/c1-7-6-10(13-3)8(2)11(12-7)9-4-5-9;1-2/h6,9H,4-5H2,1-3H3;1-2H3 |
| InChIKey | UPWJUVZRMCYOJY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclopropyl-4-methoxy-3,6-dimethylpyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-4-methoxy-3,6-dimethylpyridine;ethane?
The IUPAC name of 2-cyclopropyl-4-methoxy-3,6-dimethylpyridine;ethane (CID 177024398) is 2-cyclopropyl-4-methoxy-3,6-dimethylpyridine;ethane.
What is the SMILES notation for 2-cyclopropyl-4-methoxy-3,6-dimethylpyridine;ethane?
The canonical SMILES for 2-cyclopropyl-4-methoxy-3,6-dimethylpyridine;ethane is CC.COc1cc(C)nc(C2CC2)c1C.
What is the InChIKey of 2-cyclopropyl-4-methoxy-3,6-dimethylpyridine;ethane?
The InChIKey is UPWJUVZRMCYOJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO.C2H6/c1-7-6-10(13-3)8(2)11(12-7)9-4-5-9;1-2/h6,9H,4-5H2,1-3H3;1-2H3.
What are the key properties of 2-cyclopropyl-4-methoxy-3,6-dimethylpyridine;ethane?
2-cyclopropyl-4-methoxy-3,6-dimethylpyridine;ethane has a molecular weight of 207.32 g/mol, XLogP of 3.61, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-4-methoxy-3,6-dimethylpyridine;ethane is sourced from PubChem (CID 177024398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).