About 1,1-difluoro-2,4-dimethylcyclopentane;5-methylpyrazine-2-carboxylic acid
1,1-difluoro-2,4-dimethylcyclopentane;5-methylpyrazine-2-carboxylic acid (PubChem CID 177025154) has the molecular formula C13H18F2N2O2
and a molecular weight of 272.29 g/mol. Its IUPAC name is 1,1-difluoro-2,4-dimethylcyclopentane;5-methylpyrazine-2-carboxylic acid.
Molecular Properties
| Compound Name | 1,1-difluoro-2,4-dimethylcyclopentane;5-methylpyrazine-2-carboxylic acid |
| PubChem CID | 177025154 |
| Molecular Formula | C13H18F2N2O2 |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 1,1-difluoro-2,4-dimethylcyclopentane;5-methylpyrazine-2-carboxylic acid |
| SMILES | CC1CC(C)C(F)(F)C1.Cc1cnc(C(=O)O)cn1 |
| InChI | InChI=1S/C7H12F2.C6H6N2O2/c1-5-3-6(2)7(8,9)4-5;1-4-2-8-5(3-7-4)6(9)10/h5-6H,3-4H2,1-2H3;2-3H,1H3,(H,9,10) |
| InChIKey | AOIJXMMWWNNALJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,1-difluoro-2,4-dimethylcyclopentane;5-methylpyrazine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoro-2,4-dimethylcyclopentane;5-methylpyrazine-2-carboxylic acid?
The IUPAC name of 1,1-difluoro-2,4-dimethylcyclopentane;5-methylpyrazine-2-carboxylic acid (CID 177025154) is 1,1-difluoro-2,4-dimethylcyclopentane;5-methylpyrazine-2-carboxylic acid.
What is the SMILES notation for 1,1-difluoro-2,4-dimethylcyclopentane;5-methylpyrazine-2-carboxylic acid?
The canonical SMILES for 1,1-difluoro-2,4-dimethylcyclopentane;5-methylpyrazine-2-carboxylic acid is CC1CC(C)C(F)(F)C1.Cc1cnc(C(=O)O)cn1.
What is the InChIKey of 1,1-difluoro-2,4-dimethylcyclopentane;5-methylpyrazine-2-carboxylic acid?
The InChIKey is AOIJXMMWWNNALJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12F2.C6H6N2O2/c1-5-3-6(2)7(8,9)4-5;1-4-2-8-5(3-7-4)6(9)10/h5-6H,3-4H2,1-2H3;2-3H,1H3,(H,9,10).
What are the key properties of 1,1-difluoro-2,4-dimethylcyclopentane;5-methylpyrazine-2-carboxylic acid?
1,1-difluoro-2,4-dimethylcyclopentane;5-methylpyrazine-2-carboxylic acid has a molecular weight of 272.29 g/mol, XLogP of 3.17, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoro-2,4-dimethylcyclopentane;5-methylpyrazine-2-carboxylic acid is sourced from PubChem (CID 177025154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).