About 7-butan-2-yl-6-methoxy-3,4-dihydro-2H-1,4-benzoxazine
7-butan-2-yl-6-methoxy-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 177025565) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is 7-butan-2-yl-6-methoxy-3,4-dihydro-2H-1,4-benzoxazine.
Molecular Properties
| Compound Name | 7-butan-2-yl-6-methoxy-3,4-dihydro-2H-1,4-benzoxazine |
| PubChem CID | 177025565 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 7-butan-2-yl-6-methoxy-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | CCC(C)c1cc2c(cc1OC)NCCO2 |
| InChI | InChI=1S/C13H19NO2/c1-4-9(2)10-7-13-11(8-12(10)15-3)14-5-6-16-13/h7-9,14H,4-6H2,1-3H3 |
| InChIKey | DNNDDSKNPVYGJN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-butan-2-yl-6-methoxy-3,4-dihydro-2H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-butan-2-yl-6-methoxy-3,4-dihydro-2H-1,4-benzoxazine?
The IUPAC name of 7-butan-2-yl-6-methoxy-3,4-dihydro-2H-1,4-benzoxazine (CID 177025565) is 7-butan-2-yl-6-methoxy-3,4-dihydro-2H-1,4-benzoxazine.
What is the SMILES notation for 7-butan-2-yl-6-methoxy-3,4-dihydro-2H-1,4-benzoxazine?
The canonical SMILES for 7-butan-2-yl-6-methoxy-3,4-dihydro-2H-1,4-benzoxazine is CCC(C)c1cc2c(cc1OC)NCCO2.
What is the InChIKey of 7-butan-2-yl-6-methoxy-3,4-dihydro-2H-1,4-benzoxazine?
The InChIKey is DNNDDSKNPVYGJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2/c1-4-9(2)10-7-13-11(8-12(10)15-3)14-5-6-16-13/h7-9,14H,4-6H2,1-3H3.
What are the key properties of 7-butan-2-yl-6-methoxy-3,4-dihydro-2H-1,4-benzoxazine?
7-butan-2-yl-6-methoxy-3,4-dihydro-2H-1,4-benzoxazine has a molecular weight of 221.30 g/mol, XLogP of 3.01, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-butan-2-yl-6-methoxy-3,4-dihydro-2H-1,4-benzoxazine is sourced from PubChem (CID 177025565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).