C25H31N3O4 — CID 177026527
2-[3-[[3-[hydroxy-(1-methylpyrrolidin-2-yl)methyl]-1H-indol-5-yl]oxy]propyl]-4,5,6,7-tetrahydroisoindole-1,3-dione (PubChem CID 177026527) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is 2-[3-[[3-[hydroxy-(1-methylpyrrolidin-2-yl)methyl]-1H-indol-5-yl]oxy]propyl]-4,5,6,7-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[3-[[3-[hydroxy-(1-methylpyrrolidin-2-yl)methyl]-1H-indol-5-yl]oxy]propyl]-4,5,6,7-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 177026527 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 2-[3-[[3-[hydroxy-(1-methylpyrrolidin-2-yl)methyl]-1H-indol-5-yl]oxy]propyl]-4,5,6,7-tetrahydroisoindole-1,3-dione |
| SMILES | CN1CCCC1C(O)c1c[nH]c2ccc(OCCCN3C(=O)C4=C(CCCC4)C3=O)cc12 |
| InChI | InChI=1S/C25H31N3O4/c1-27-11-4-8-22(27)23(29)20-15-26-21-10-9-16(14-19(20)21)32-13-5-12-28-24(30)17-6-2-3-7-18(17)25(28)31/h9-10,14-15,22-23,26,29H,2-8,11-13H2,1H3 |
| InChIKey | HBWHAZLSZSWRHN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 85.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|