C21H24N4O4 — CID 177026827
(4S)-5-ethoxy-4-[4-[(Z)-hydroxyiminomethyl]-2-methoxyphenyl]-2,8-dimethyl-1,4-dihydro-1,6-naphthyridine-3-carboxamide (PubChem CID 177026827) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is (4S)-5-ethoxy-4-[4-[(Z)-hydroxyiminomethyl]-2-methoxyphenyl]-2,8-dimethyl-1,4-dihydro-1,6-naphthyridine-3-carboxamide.
| Compound Name | (4S)-5-ethoxy-4-[4-[(Z)-hydroxyiminomethyl]-2-methoxyphenyl]-2,8-dimethyl-1,4-dihydro-1,6-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 177026827 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | (4S)-5-ethoxy-4-[4-[(Z)-hydroxyiminomethyl]-2-methoxyphenyl]-2,8-dimethyl-1,4-dihydro-1,6-naphthyridine-3-carboxamide |
| SMILES | CCOc1ncc(C)c2c1[C@H](c1ccc(/C=N\O)cc1OC)C(C(N)=O)=C(C)N2 |
| InChI | InChI=1S/C21H24N4O4/c1-5-29-21-18-17(14-7-6-13(10-24-27)8-15(14)28-4)16(20(22)26)12(3)25-19(18)11(2)9-23-21/h6-10,17,25,27H,5H2,1-4H3,(H2,22,26)/b24-10-/t17-/m1/s1 |
| InChIKey | BWPFAUIZQCKXPU-CIMGSBJISA-N |
| XLogP | 2.92 |
| TPSA | 119.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|