C30H31N3O6S — CID 177026830
methanethiol;phenylmethoxycarbonyl 4-(4-cyano-2-methoxyphenyl)-5-ethoxy-2,8-dimethyl-1,4-dihydro-1,6-naphthyridine-3-carboxylate (PubChem CID 177026830) has the molecular formula C30H31N3O6S and a molecular weight of 561.66 g/mol. Its IUPAC name is methanethiol;phenylmethoxycarbonyl 4-(4-cyano-2-methoxyphenyl)-5-ethoxy-2,8-dimethyl-1,4-dihydro-1,6-naphthyridine-3-carboxylate.
| Compound Name | methanethiol;phenylmethoxycarbonyl 4-(4-cyano-2-methoxyphenyl)-5-ethoxy-2,8-dimethyl-1,4-dihydro-1,6-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 177026830 |
| Molecular Formula | C30H31N3O6S |
| Molecular Weight | 561.66 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | methanethiol;phenylmethoxycarbonyl 4-(4-cyano-2-methoxyphenyl)-5-ethoxy-2,8-dimethyl-1,4-dihydro-1,6-naphthyridine-3-carboxylate |
| SMILES | CCOc1ncc(C)c2c1C(c1ccc(C#N)cc1OC)C(C(=O)OC(=O)OCc1ccccc1)=C(C)N2.CS |
| InChI | InChI=1S/C29H27N3O6.CH4S/c1-5-36-27-25-24(21-12-11-20(14-30)13-22(21)35-4)23(18(3)32-26(25)17(2)15-31-27)28(33)38-29(34)37-16-19-9-7-6-8-10-19;1-2/h6-13,15,24,32H,5,16H2,1-4H3;2H,1H3 |
| InChIKey | RZFROUIQXWPSLR-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 119.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.66 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|