About N-cyclobutylhydroxylamine;(2S)-2-(3,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-5-amine
N-cyclobutylhydroxylamine;(2S)-2-(3,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-5-amine (PubChem CID 177027227) has the molecular formula C14H19F2N3O
and a molecular weight of 283.32 g/mol. Its IUPAC name is N-cyclobutylhydroxylamine;(2S)-2-(3,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-5-amine.
Molecular Properties
| Compound Name | N-cyclobutylhydroxylamine;(2S)-2-(3,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-5-amine |
| PubChem CID | 177027227 |
| Molecular Formula | C14H19F2N3O |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | N-cyclobutylhydroxylamine;(2S)-2-(3,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-5-amine |
| SMILES | NC1=N[C@H](c2cc(F)cc(F)c2)CC1.ONC1CCC1 |
| InChI | InChI=1S/C10H10F2N2.C4H9NO/c11-7-3-6(4-8(12)5-7)9-1-2-10(13)14-9;6-5-4-2-1-3-4/h3-5,9H,1-2H2,(H2,13,14);4-6H,1-3H2/t9-;/m0./s1 |
| InChIKey | MWYKYDDGSJSHKU-FVGYRXGTSA-N |
| XLogP | 2.67 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-cyclobutylhydroxylamine;(2S)-2-(3,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclobutylhydroxylamine;(2S)-2-(3,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-5-amine?
The IUPAC name of N-cyclobutylhydroxylamine;(2S)-2-(3,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-5-amine (CID 177027227) is N-cyclobutylhydroxylamine;(2S)-2-(3,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-5-amine.
What is the SMILES notation for N-cyclobutylhydroxylamine;(2S)-2-(3,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-5-amine?
The canonical SMILES for N-cyclobutylhydroxylamine;(2S)-2-(3,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-5-amine is NC1=N[C@H](c2cc(F)cc(F)c2)CC1.ONC1CCC1.
What is the InChIKey of N-cyclobutylhydroxylamine;(2S)-2-(3,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-5-amine?
The InChIKey is MWYKYDDGSJSHKU-FVGYRXGTSA-N. The full InChI is InChI=1S/C10H10F2N2.C4H9NO/c11-7-3-6(4-8(12)5-7)9-1-2-10(13)14-9;6-5-4-2-1-3-4/h3-5,9H,1-2H2,(H2,13,14);4-6H,1-3H2/t9-;/m0./s1.
What are the key properties of N-cyclobutylhydroxylamine;(2S)-2-(3,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-5-amine?
N-cyclobutylhydroxylamine;(2S)-2-(3,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-5-amine has a molecular weight of 283.32 g/mol, XLogP of 2.67, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclobutylhydroxylamine;(2S)-2-(3,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-5-amine is sourced from PubChem (CID 177027227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).