C35H42F5N3O6 — CID 177027469
2-[(2,6-difluoro-4-morpholin-4-ylbenzoyl)amino]-3-(2,3-dihydro-1H-inden-4-yl)propanoic acid;1-(2,4-dimethoxyphenyl)-N,N-dimethylmethanamine;fluoroform (PubChem CID 177027469) has the molecular formula C35H42F5N3O6 and a molecular weight of 695.73 g/mol. Its IUPAC name is 2-[(2,6-difluoro-4-morpholin-4-ylbenzoyl)amino]-3-(2,3-dihydro-1H-inden-4-yl)propanoic acid;1-(2,4-dimethoxyphenyl)-N,N-dimethylmethanamine;fluoroform.
| Compound Name | 2-[(2,6-difluoro-4-morpholin-4-ylbenzoyl)amino]-3-(2,3-dihydro-1H-inden-4-yl)propanoic acid;1-(2,4-dimethoxyphenyl)-N,N-dimethylmethanamine;fluoroform |
|---|---|
| PubChem CID | 177027469 |
| Molecular Formula | C35H42F5N3O6 |
| Molecular Weight | 695.73 g/mol |
| Exact Mass | 695.30 |
| IUPAC Name | 2-[(2,6-difluoro-4-morpholin-4-ylbenzoyl)amino]-3-(2,3-dihydro-1H-inden-4-yl)propanoic acid;1-(2,4-dimethoxyphenyl)-N,N-dimethylmethanamine;fluoroform |
| SMILES | COc1ccc(CN(C)C)c(OC)c1.FC(F)F.O=C(NC(Cc1cccc2c1CCC2)C(=O)O)c1c(F)cc(N2CCOCC2)cc1F |
| InChI | InChI=1S/C23H24F2N2O4.C11H17NO2.CHF3/c24-18-12-16(27-7-9-31-10-8-27)13-19(25)21(18)22(28)26-20(23(29)30)11-15-5-1-3-14-4-2-6-17(14)15;1-12(2)8-9-5-6-10(13-3)7-11(9)14-4;2-1(3)4/h1,3,5,12-13,20H,2,4,6-11H2,(H,26,28)(H,29,30);5-7H,8H2,1-4H3;1H |
| InChIKey | MKEOLMVPVAEKAH-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 100.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.73 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |