C23H32FN5O4 — CID 177027774
1-[4-[7-(dimethoxymethyl)-2-azaspiro[3.5]nonan-2-yl]-5-fluoro-2-(methylamino)benzenecarboximidoyl]-1,3-diazinane-2,4-dione (PubChem CID 177027774) has the molecular formula C23H32FN5O4 and a molecular weight of 461.54 g/mol. Its IUPAC name is 1-[4-[7-(dimethoxymethyl)-2-azaspiro[3.5]nonan-2-yl]-5-fluoro-2-(methylamino)benzenecarboximidoyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[4-[7-(dimethoxymethyl)-2-azaspiro[3.5]nonan-2-yl]-5-fluoro-2-(methylamino)benzenecarboximidoyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 177027774 |
| Molecular Formula | C23H32FN5O4 |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | 1-[4-[7-(dimethoxymethyl)-2-azaspiro[3.5]nonan-2-yl]-5-fluoro-2-(methylamino)benzenecarboximidoyl]-1,3-diazinane-2,4-dione |
| SMILES | [H]/N=C(/c1cc(F)c(N2CC3(CCC(C(OC)OC)CC3)C2)cc1NC)N1CCC(=O)NC1=O |
| InChI | InChI=1S/C23H32FN5O4/c1-26-17-11-18(16(24)10-15(17)20(25)29-9-6-19(30)27-22(29)31)28-12-23(13-28)7-4-14(5-8-23)21(32-2)33-3/h10-11,14,21,25-26H,4-9,12-13H2,1-3H3,(H,27,30,31)/b25-20- |
| InChIKey | ZGWAQLYBUVXCFW-QQTULTPQSA-N |
| XLogP | 2.75 |
| TPSA | 106.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|