C27H33ClN2O — CID 177027788
2-chloro-6-methyl-N-(5,5,7-trimethyl-2-piperidin-4-yl-8,9-dihydro-7H-benzo[7]annulen-6-ylidene)benzamide (PubChem CID 177027788) has the molecular formula C27H33ClN2O and a molecular weight of 437.03 g/mol. Its IUPAC name is 2-chloro-6-methyl-N-(5,5,7-trimethyl-2-piperidin-4-yl-8,9-dihydro-7H-benzo[7]annulen-6-ylidene)benzamide.
| Compound Name | 2-chloro-6-methyl-N-(5,5,7-trimethyl-2-piperidin-4-yl-8,9-dihydro-7H-benzo[7]annulen-6-ylidene)benzamide |
|---|---|
| PubChem CID | 177027788 |
| Molecular Formula | C27H33ClN2O |
| Molecular Weight | 437.03 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 2-chloro-6-methyl-N-(5,5,7-trimethyl-2-piperidin-4-yl-8,9-dihydro-7H-benzo[7]annulen-6-ylidene)benzamide |
| SMILES | Cc1cccc(Cl)c1C(=O)/N=C1\C(C)CCc2cc(C3CCNCC3)ccc2C1(C)C |
| InChI | InChI=1S/C27H33ClN2O/c1-17-6-5-7-23(28)24(17)26(31)30-25-18(2)8-9-21-16-20(19-12-14-29-15-13-19)10-11-22(21)27(25,3)4/h5-7,10-11,16,18-19,29H,8-9,12-15H2,1-4H3/b30-25+ |
| InChIKey | AVOIDAADQJFHDC-QCWLDUFUSA-N |
| XLogP | 6.26 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.03 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|