C18H30N2 — CID 177028413
methane;3-propan-2-ylpyridine;4-propan-2-ylpyridine (PubChem CID 177028413) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is methane;3-propan-2-ylpyridine;4-propan-2-ylpyridine.
| Compound Name | methane;3-propan-2-ylpyridine;4-propan-2-ylpyridine |
|---|---|
| PubChem CID | 177028413 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | methane;3-propan-2-ylpyridine;4-propan-2-ylpyridine |
| SMILES | C.C.CC(C)c1cccnc1.CC(C)c1ccncc1 |
| InChI | InChI=1S/2C8H11N.2CH4/c1-7(2)8-3-5-9-6-4-8;1-7(2)8-4-3-5-9-6-8;;/h2*3-7H,1-2H3;2*1H4 |
| InChIKey | HXEMEACAWPDCGE-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |