About 2-[2-[2-[methyl-(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxy]acetic acid
2-[2-[2-[methyl-(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxy]acetic acid (PubChem CID 177028617) has the molecular formula C9H14F3NO5
and a molecular weight of 273.21 g/mol. Its IUPAC name is 2-[2-[2-[methyl-(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxy]acetic acid.
Molecular Properties
| Compound Name | 2-[2-[2-[methyl-(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxy]acetic acid |
| PubChem CID | 177028617 |
| Molecular Formula | C9H14F3NO5 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-[2-[2-[methyl-(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxy]acetic acid |
| SMILES | CN(CCOCCOCC(=O)O)C(=O)C(F)(F)F |
| InChI | InChI=1S/C9H14F3NO5/c1-13(8(16)9(10,11)12)2-3-17-4-5-18-6-7(14)15/h2-6H2,1H3,(H,14,15) |
| InChIKey | CGPHLKYYCKJQQI-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[2-[methyl-(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-[methyl-(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxy]acetic acid?
The IUPAC name of 2-[2-[2-[methyl-(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxy]acetic acid (CID 177028617) is 2-[2-[2-[methyl-(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxy]acetic acid.
What is the SMILES notation for 2-[2-[2-[methyl-(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxy]acetic acid?
The canonical SMILES for 2-[2-[2-[methyl-(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxy]acetic acid is CN(CCOCCOCC(=O)O)C(=O)C(F)(F)F.
What is the InChIKey of 2-[2-[2-[methyl-(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxy]acetic acid?
The InChIKey is CGPHLKYYCKJQQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F3NO5/c1-13(8(16)9(10,11)12)2-3-17-4-5-18-6-7(14)15/h2-6H2,1H3,(H,14,15).
What are the key properties of 2-[2-[2-[methyl-(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxy]acetic acid?
2-[2-[2-[methyl-(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxy]acetic acid has a molecular weight of 273.21 g/mol, XLogP of 0.12, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-[methyl-(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxy]acetic acid is sourced from PubChem (CID 177028617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).