About N-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)formamide
N-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)formamide (PubChem CID 177028638) has the molecular formula C5H6N2O4
and a molecular weight of 158.11 g/mol. Its IUPAC name is N-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)formamide.
Molecular Properties
| Compound Name | N-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)formamide |
| PubChem CID | 177028638 |
| Molecular Formula | C5H6N2O4 |
| Molecular Weight | 158.11 g/mol |
| Exact Mass | 158.03 |
| IUPAC Name | N-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)formamide |
| SMILES | O=CNC1CC(=O)N(O)C1=O |
| InChI | InChI=1S/C5H6N2O4/c8-2-6-3-1-4(9)7(11)5(3)10/h2-3,11H,1H2,(H,6,8) |
| InChIKey | FKPJBMNDSCPCNV-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.11 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)formamide?
The IUPAC name of N-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)formamide (CID 177028638) is N-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)formamide.
What is the SMILES notation for N-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)formamide?
The canonical SMILES for N-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)formamide is O=CNC1CC(=O)N(O)C1=O.
What is the InChIKey of N-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)formamide?
The InChIKey is FKPJBMNDSCPCNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O4/c8-2-6-3-1-4(9)7(11)5(3)10/h2-3,11H,1H2,(H,6,8).
What are the key properties of N-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)formamide?
N-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)formamide has a molecular weight of 158.11 g/mol, XLogP of -1.75, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)formamide is sourced from PubChem (CID 177028638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).