C26H35N3O3 — CID 177029351
2-(3-ethylphenyl)-2-[3-[5-(1,2,3,4-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]azetidin-1-yl]acetic acid (PubChem CID 177029351) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is 2-(3-ethylphenyl)-2-[3-[5-(1,2,3,4-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]azetidin-1-yl]acetic acid.
| Compound Name | 2-(3-ethylphenyl)-2-[3-[5-(1,2,3,4-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]azetidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 177029351 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | 2-(3-ethylphenyl)-2-[3-[5-(1,2,3,4-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]azetidin-1-yl]acetic acid |
| SMILES | CCc1cccc(C(C(=O)O)N2CC(OCCCCCC3CCc4cccnc4N3)C2)c1 |
| InChI | InChI=1S/C26H35N3O3/c1-2-19-8-6-9-21(16-19)24(26(30)31)29-17-23(18-29)32-15-5-3-4-11-22-13-12-20-10-7-14-27-25(20)28-22/h6-10,14,16,22-24H,2-5,11-13,15,17-18H2,1H3,(H,27,28)(H,30,31) |
| InChIKey | JPNGBWASTRDTET-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|