About 4-(4-propan-2-ylcyclohexyl)morpholine;1,1,1-trifluoroethane
4-(4-propan-2-ylcyclohexyl)morpholine;1,1,1-trifluoroethane (PubChem CID 177029774) has the molecular formula C15H28F3NO
and a molecular weight of 295.39 g/mol. Its IUPAC name is 4-(4-propan-2-ylcyclohexyl)morpholine;1,1,1-trifluoroethane.
Molecular Properties
| Compound Name | 4-(4-propan-2-ylcyclohexyl)morpholine;1,1,1-trifluoroethane |
| PubChem CID | 177029774 |
| Molecular Formula | C15H28F3NO |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 4-(4-propan-2-ylcyclohexyl)morpholine;1,1,1-trifluoroethane |
| SMILES | CC(C)C1CCC(N2CCOCC2)CC1.CC(F)(F)F |
| InChI | InChI=1S/C13H25NO.C2H3F3/c1-11(2)12-3-5-13(6-4-12)14-7-9-15-10-8-14;1-2(3,4)5/h11-13H,3-10H2,1-2H3;1H3 |
| InChIKey | XOSCDTGADXLCAZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4-propan-2-ylcyclohexyl)morpholine;1,1,1-trifluoroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-propan-2-ylcyclohexyl)morpholine;1,1,1-trifluoroethane?
The IUPAC name of 4-(4-propan-2-ylcyclohexyl)morpholine;1,1,1-trifluoroethane (CID 177029774) is 4-(4-propan-2-ylcyclohexyl)morpholine;1,1,1-trifluoroethane.
What is the SMILES notation for 4-(4-propan-2-ylcyclohexyl)morpholine;1,1,1-trifluoroethane?
The canonical SMILES for 4-(4-propan-2-ylcyclohexyl)morpholine;1,1,1-trifluoroethane is CC(C)C1CCC(N2CCOCC2)CC1.CC(F)(F)F.
What is the InChIKey of 4-(4-propan-2-ylcyclohexyl)morpholine;1,1,1-trifluoroethane?
The InChIKey is XOSCDTGADXLCAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO.C2H3F3/c1-11(2)12-3-5-13(6-4-12)14-7-9-15-10-8-14;1-2(3,4)5/h11-13H,3-10H2,1-2H3;1H3.
What are the key properties of 4-(4-propan-2-ylcyclohexyl)morpholine;1,1,1-trifluoroethane?
4-(4-propan-2-ylcyclohexyl)morpholine;1,1,1-trifluoroethane has a molecular weight of 295.39 g/mol, XLogP of 4.10, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-propan-2-ylcyclohexyl)morpholine;1,1,1-trifluoroethane is sourced from PubChem (CID 177029774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).