C25H32N2O2 — CID 177030242
ethane;methyl 3-[3-[[5-[(dimethylamino)methyl]isoquinolin-1-yl]methyl]phenyl]propanoate (PubChem CID 177030242) has the molecular formula C25H32N2O2 and a molecular weight of 392.54 g/mol. Its IUPAC name is ethane;methyl 3-[3-[[5-[(dimethylamino)methyl]isoquinolin-1-yl]methyl]phenyl]propanoate.
| Compound Name | ethane;methyl 3-[3-[[5-[(dimethylamino)methyl]isoquinolin-1-yl]methyl]phenyl]propanoate |
|---|---|
| PubChem CID | 177030242 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | ethane;methyl 3-[3-[[5-[(dimethylamino)methyl]isoquinolin-1-yl]methyl]phenyl]propanoate |
| SMILES | CC.COC(=O)CCc1cccc(Cc2nccc3c(CN(C)C)cccc23)c1 |
| InChI | InChI=1S/C23H26N2O2.C2H6/c1-25(2)16-19-8-5-9-21-20(19)12-13-24-22(21)15-18-7-4-6-17(14-18)10-11-23(26)27-3;1-2/h4-9,12-14H,10-11,15-16H2,1-3H3;1-2H3 |
| InChIKey | OQTVNWCILDEBEI-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |