C25H28N2O2 — CID 177030713
3-[3-[[6-(piperidin-1-ylmethyl)isoquinolin-8-yl]methyl]phenyl]propanoic acid (PubChem CID 177030713) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is 3-[3-[[6-(piperidin-1-ylmethyl)isoquinolin-8-yl]methyl]phenyl]propanoic acid.
| Compound Name | 3-[3-[[6-(piperidin-1-ylmethyl)isoquinolin-8-yl]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 177030713 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 3-[3-[[6-(piperidin-1-ylmethyl)isoquinolin-8-yl]methyl]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1cccc(Cc2cc(CN3CCCCC3)cc3ccncc23)c1 |
| InChI | InChI=1S/C25H28N2O2/c28-25(29)8-7-19-5-4-6-20(13-19)14-23-16-21(18-27-11-2-1-3-12-27)15-22-9-10-26-17-24(22)23/h4-6,9-10,13,15-17H,1-3,7-8,11-12,14,18H2,(H,28,29) |
| InChIKey | ZYYKBWUXUDNDIK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |