C27H28F3NO6 — CID 177030777
methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-[(E)-4,4,4-trifluoro-2-formyl-3-(3-formylphenyl)but-2-enyl]phenyl]propanoate (PubChem CID 177030777) has the molecular formula C27H28F3NO6 and a molecular weight of 519.52 g/mol. Its IUPAC name is methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-[(E)-4,4,4-trifluoro-2-formyl-3-(3-formylphenyl)but-2-enyl]phenyl]propanoate.
| Compound Name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-[(E)-4,4,4-trifluoro-2-formyl-3-(3-formylphenyl)but-2-enyl]phenyl]propanoate |
|---|---|
| PubChem CID | 177030777 |
| Molecular Formula | C27H28F3NO6 |
| Molecular Weight | 519.52 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-[(E)-4,4,4-trifluoro-2-formyl-3-(3-formylphenyl)but-2-enyl]phenyl]propanoate |
| SMILES | COC(=O)[C@H](Cc1cccc(C/C(C=O)=C(/c2cccc(C=O)c2)C(F)(F)F)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H28F3NO6/c1-26(2,3)37-25(35)31-22(24(34)36-4)14-18-8-5-7-17(11-18)12-21(16-33)23(27(28,29)30)20-10-6-9-19(13-20)15-32/h5-11,13,15-16,22H,12,14H2,1-4H3,(H,31,35)/b23-21+/t22-/m0/s1 |
| InChIKey | YMYDRWFFUYLOJL-MOBKVPTQSA-N |
| XLogP | 4.87 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.52 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|