C29H31F4N5O5 — CID 177031468
2-[[5-[[(4R)-3-[[4-fluoro-3-(trifluoromethyl)phenyl]carbamoyl]-2-bicyclo[2.2.1]heptanyl]carbamoyl]-6-methoxypyrimidin-4-yl]amino]spiro[3.3]heptane-6-carboxylic acid (PubChem CID 177031468) has the molecular formula C29H31F4N5O5 and a molecular weight of 605.59 g/mol. Its IUPAC name is 2-[[5-[[(4R)-3-[[4-fluoro-3-(trifluoromethyl)phenyl]carbamoyl]-2-bicyclo[2.2.1]heptanyl]carbamoyl]-6-methoxypyrimidin-4-yl]amino]spiro[3.3]heptane-6-carboxylic acid.
| Compound Name | 2-[[5-[[(4R)-3-[[4-fluoro-3-(trifluoromethyl)phenyl]carbamoyl]-2-bicyclo[2.2.1]heptanyl]carbamoyl]-6-methoxypyrimidin-4-yl]amino]spiro[3.3]heptane-6-carboxylic acid |
|---|---|
| PubChem CID | 177031468 |
| Molecular Formula | C29H31F4N5O5 |
| Molecular Weight | 605.59 g/mol |
| Exact Mass | 605.23 |
| IUPAC Name | 2-[[5-[[(4R)-3-[[4-fluoro-3-(trifluoromethyl)phenyl]carbamoyl]-2-bicyclo[2.2.1]heptanyl]carbamoyl]-6-methoxypyrimidin-4-yl]amino]spiro[3.3]heptane-6-carboxylic acid |
| SMILES | COc1ncnc(NC2CC3(C2)CC(C(=O)O)C3)c1C(=O)NC1C2CC[C@H](C2)C1C(=O)Nc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H31F4N5O5/c1-43-26-21(23(34-12-35-26)36-17-10-28(11-17)8-15(9-28)27(41)42)25(40)38-22-14-3-2-13(6-14)20(22)24(39)37-16-4-5-19(30)18(7-16)29(31,32)33/h4-5,7,12-15,17,20,22H,2-3,6,8-11H2,1H3,(H,37,39)(H,38,40)(H,41,42)(H,34,35,36)/t13-,14?,15?,17?,20?,22?,28?/m1/s1 |
| InChIKey | GPWCLRKYKDOJMD-UHFGNOPKSA-N |
| XLogP | 4.48 |
| TPSA | 142.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.59 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |