About 1-[(E)-2,2-difluoropent-3-enyl]-2,2-dimethylpyrrolidine
1-[(E)-2,2-difluoropent-3-enyl]-2,2-dimethylpyrrolidine (PubChem CID 177031720) has the molecular formula C11H19F2N
and a molecular weight of 203.28 g/mol. Its IUPAC name is 1-[(E)-2,2-difluoropent-3-enyl]-2,2-dimethylpyrrolidine.
Molecular Properties
| Compound Name | 1-[(E)-2,2-difluoropent-3-enyl]-2,2-dimethylpyrrolidine |
| PubChem CID | 177031720 |
| Molecular Formula | C11H19F2N |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | 1-[(E)-2,2-difluoropent-3-enyl]-2,2-dimethylpyrrolidine |
| SMILES | C/C=C/C(F)(F)CN1CCCC1(C)C |
| InChI | InChI=1S/C11H19F2N/c1-4-6-11(12,13)9-14-8-5-7-10(14,2)3/h4,6H,5,7-9H2,1-3H3/b6-4+ |
| InChIKey | DUNYZBVNOKWENW-GQCTYLIASA-N |
| XLogP | 3.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-2,2-difluoropent-3-enyl]-2,2-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-2,2-difluoropent-3-enyl]-2,2-dimethylpyrrolidine?
The IUPAC name of 1-[(E)-2,2-difluoropent-3-enyl]-2,2-dimethylpyrrolidine (CID 177031720) is 1-[(E)-2,2-difluoropent-3-enyl]-2,2-dimethylpyrrolidine.
What is the SMILES notation for 1-[(E)-2,2-difluoropent-3-enyl]-2,2-dimethylpyrrolidine?
The canonical SMILES for 1-[(E)-2,2-difluoropent-3-enyl]-2,2-dimethylpyrrolidine is C/C=C/C(F)(F)CN1CCCC1(C)C.
What is the InChIKey of 1-[(E)-2,2-difluoropent-3-enyl]-2,2-dimethylpyrrolidine?
The InChIKey is DUNYZBVNOKWENW-GQCTYLIASA-N. The full InChI is InChI=1S/C11H19F2N/c1-4-6-11(12,13)9-14-8-5-7-10(14,2)3/h4,6H,5,7-9H2,1-3H3/b6-4+.
What are the key properties of 1-[(E)-2,2-difluoropent-3-enyl]-2,2-dimethylpyrrolidine?
1-[(E)-2,2-difluoropent-3-enyl]-2,2-dimethylpyrrolidine has a molecular weight of 203.28 g/mol, XLogP of 3.07, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-2,2-difluoropent-3-enyl]-2,2-dimethylpyrrolidine is sourced from PubChem (CID 177031720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).