C14H20F3NO2 — CID 177032680
(2Z,4E)-5-(piperidin-1-ylmethyl)-3-(trifluoromethoxy)hepta-2,4,6-trien-2-ol (PubChem CID 177032680) has the molecular formula C14H20F3NO2 and a molecular weight of 291.31 g/mol. Its IUPAC name is (2Z,4E)-5-(piperidin-1-ylmethyl)-3-(trifluoromethoxy)hepta-2,4,6-trien-2-ol.
| Compound Name | (2Z,4E)-5-(piperidin-1-ylmethyl)-3-(trifluoromethoxy)hepta-2,4,6-trien-2-ol |
|---|---|
| PubChem CID | 177032680 |
| Molecular Formula | C14H20F3NO2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | (2Z,4E)-5-(piperidin-1-ylmethyl)-3-(trifluoromethoxy)hepta-2,4,6-trien-2-ol |
| SMILES | C=C/C(=C\C(OC(F)(F)F)=C(/C)O)CN1CCCCC1 |
| InChI | InChI=1S/C14H20F3NO2/c1-3-12(10-18-7-5-4-6-8-18)9-13(11(2)19)20-14(15,16)17/h3,9,19H,1,4-8,10H2,2H3/b12-9+,13-11- |
| InChIKey | QSESGUJLXDKVRD-NYGJOUKGSA-N |
| XLogP | 3.91 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|