C9H18N2 — CID 177032786
5-ethyl-2-(2-methylpropyl)-1,5-dihydropyrazole (PubChem CID 177032786) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is 5-ethyl-2-(2-methylpropyl)-1,5-dihydropyrazole.
| Compound Name | 5-ethyl-2-(2-methylpropyl)-1,5-dihydropyrazole |
|---|---|
| PubChem CID | 177032786 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 5-ethyl-2-(2-methylpropyl)-1,5-dihydropyrazole |
| SMILES | CCC1C=CN(CC(C)C)N1 |
| InChI | InChI=1S/C9H18N2/c1-4-9-5-6-11(10-9)7-8(2)3/h5-6,8-10H,4,7H2,1-3H3 |
| InChIKey | QGWJAHFILRUBHK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |