C9H18N2O — CID 177033685
1-ethanimidoyl-2,6-dimethylpiperidin-4-ol (PubChem CID 177033685) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is 1-ethanimidoyl-2,6-dimethylpiperidin-4-ol.
| Compound Name | 1-ethanimidoyl-2,6-dimethylpiperidin-4-ol |
|---|---|
| PubChem CID | 177033685 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 1-ethanimidoyl-2,6-dimethylpiperidin-4-ol |
| SMILES | [H]/N=C(\C)N1C(C)CC(O)CC1C |
| InChI | InChI=1S/C9H18N2O/c1-6-4-9(12)5-7(2)11(6)8(3)10/h6-7,9-10,12H,4-5H2,1-3H3/b10-8+ |
| InChIKey | NARCRBYYBMCRKA-CSKARUKUSA-N |
| XLogP | 1.22 |
| TPSA | 47.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|