C11H20ClN3O2 — CID 177033762
ethyl (E)-2-amino-3-chloro-3-(2,5,6,7-tetrahydro-1H-1,4-diazepin-3-yl)prop-2-enoate;methane (PubChem CID 177033762) has the molecular formula C11H20ClN3O2 and a molecular weight of 261.75 g/mol. Its IUPAC name is ethyl (E)-2-amino-3-chloro-3-(2,5,6,7-tetrahydro-1H-1,4-diazepin-3-yl)prop-2-enoate;methane.
| Compound Name | ethyl (E)-2-amino-3-chloro-3-(2,5,6,7-tetrahydro-1H-1,4-diazepin-3-yl)prop-2-enoate;methane |
|---|---|
| PubChem CID | 177033762 |
| Molecular Formula | C11H20ClN3O2 |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | ethyl (E)-2-amino-3-chloro-3-(2,5,6,7-tetrahydro-1H-1,4-diazepin-3-yl)prop-2-enoate;methane |
| SMILES | C.CCOC(=O)/C(N)=C(\Cl)C1=NCCCNC1 |
| InChI | InChI=1S/C10H16ClN3O2.CH4/c1-2-16-10(15)9(12)8(11)7-6-13-4-3-5-14-7;/h13H,2-6,12H2,1H3;1H4/b9-8+; |
| InChIKey | DXTIIDHQNSFETD-HRNDJLQDSA-N |
| XLogP | 1.03 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|