C26H48BN3O2 — CID 177033786
ethane;1-[1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidin-4-yl]piperazine (PubChem CID 177033786) has the molecular formula C26H48BN3O2 and a molecular weight of 445.50 g/mol. Its IUPAC name is ethane;1-[1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidin-4-yl]piperazine.
| Compound Name | ethane;1-[1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidin-4-yl]piperazine |
|---|---|
| PubChem CID | 177033786 |
| Molecular Formula | C26H48BN3O2 |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.38 |
| IUPAC Name | ethane;1-[1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidin-4-yl]piperazine |
| SMILES | CC.CC.CC1(C)OB(c2ccc(CN3CCC(N4CCNCC4)CC3)cc2)OC1(C)C |
| InChI | InChI=1S/C22H36BN3O2.2C2H6/c1-21(2)22(3,4)28-23(27-21)19-7-5-18(6-8-19)17-25-13-9-20(10-14-25)26-15-11-24-12-16-26;2*1-2/h5-8,20,24H,9-17H2,1-4H3;2*1-2H3 |
| InChIKey | PQPCOOGCAQJPDV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|