About ethane;[3-(2-methylsulfanylpropan-2-yl)-1H-1,2,4-triazol-5-yl]methanamine
ethane;[3-(2-methylsulfanylpropan-2-yl)-1H-1,2,4-triazol-5-yl]methanamine (PubChem CID 177033840) has the molecular formula C11H26N4S
and a molecular weight of 246.42 g/mol. Its IUPAC name is ethane;[3-(2-methylsulfanylpropan-2-yl)-1H-1,2,4-triazol-5-yl]methanamine.
Molecular Properties
| Compound Name | ethane;[3-(2-methylsulfanylpropan-2-yl)-1H-1,2,4-triazol-5-yl]methanamine |
| PubChem CID | 177033840 |
| Molecular Formula | C11H26N4S |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | ethane;[3-(2-methylsulfanylpropan-2-yl)-1H-1,2,4-triazol-5-yl]methanamine |
| SMILES | CC.CC.CSC(C)(C)c1n[nH]c(CN)n1 |
| InChI | InChI=1S/C7H14N4S.2C2H6/c1-7(2,12-3)6-9-5(4-8)10-11-6;2*1-2/h4,8H2,1-3H3,(H,9,10,11);2*1-2H3 |
| InChIKey | SKNUYJJVQNLLRM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;[3-(2-methylsulfanylpropan-2-yl)-1H-1,2,4-triazol-5-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[3-(2-methylsulfanylpropan-2-yl)-1H-1,2,4-triazol-5-yl]methanamine?
The IUPAC name of ethane;[3-(2-methylsulfanylpropan-2-yl)-1H-1,2,4-triazol-5-yl]methanamine (CID 177033840) is ethane;[3-(2-methylsulfanylpropan-2-yl)-1H-1,2,4-triazol-5-yl]methanamine.
What is the SMILES notation for ethane;[3-(2-methylsulfanylpropan-2-yl)-1H-1,2,4-triazol-5-yl]methanamine?
The canonical SMILES for ethane;[3-(2-methylsulfanylpropan-2-yl)-1H-1,2,4-triazol-5-yl]methanamine is CC.CC.CSC(C)(C)c1n[nH]c(CN)n1.
What is the InChIKey of ethane;[3-(2-methylsulfanylpropan-2-yl)-1H-1,2,4-triazol-5-yl]methanamine?
The InChIKey is SKNUYJJVQNLLRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4S.2C2H6/c1-7(2,12-3)6-9-5(4-8)10-11-6;2*1-2/h4,8H2,1-3H3,(H,9,10,11);2*1-2H3.
What are the key properties of ethane;[3-(2-methylsulfanylpropan-2-yl)-1H-1,2,4-triazol-5-yl]methanamine?
ethane;[3-(2-methylsulfanylpropan-2-yl)-1H-1,2,4-triazol-5-yl]methanamine has a molecular weight of 246.42 g/mol, XLogP of 2.91, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[3-(2-methylsulfanylpropan-2-yl)-1H-1,2,4-triazol-5-yl]methanamine is sourced from PubChem (CID 177033840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).