C10H13N3O — CID 177034392
1-(2-methoxyethyl)-5-methylpyrazolo[4,5-b]pyridine (PubChem CID 177034392) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-5-methylpyrazolo[4,5-b]pyridine.
| Compound Name | 1-(2-methoxyethyl)-5-methylpyrazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 177034392 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 1-(2-methoxyethyl)-5-methylpyrazolo[4,5-b]pyridine |
| SMILES | COCCn1ncc2nc(C)ccc21 |
| InChI | InChI=1S/C10H13N3O/c1-8-3-4-10-9(12-8)7-11-13(10)5-6-14-2/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | WUZQMQLTPQYEPV-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |