About (2-oxo-1H-pyridin-3-yl) hypofluorite
(2-oxo-1H-pyridin-3-yl) hypofluorite (PubChem CID 177034664) has the molecular formula C5H4FNO2
and a molecular weight of 129.09 g/mol. Its IUPAC name is (2-oxo-1H-pyridin-3-yl) hypofluorite.
Molecular Properties
| Compound Name | (2-oxo-1H-pyridin-3-yl) hypofluorite |
| PubChem CID | 177034664 |
| Molecular Formula | C5H4FNO2 |
| Molecular Weight | 129.09 g/mol |
| Exact Mass | 129.02 |
| IUPAC Name | (2-oxo-1H-pyridin-3-yl) hypofluorite |
| SMILES | O=c1[nH]cccc1OF |
| InChI | InChI=1S/C5H4FNO2/c6-9-4-2-1-3-7-5(4)8/h1-3H,(H,7,8) |
| InChIKey | PWVDMRBLPFRHBN-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.09 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2-oxo-1H-pyridin-3-yl) hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-1H-pyridin-3-yl) hypofluorite?
The IUPAC name of (2-oxo-1H-pyridin-3-yl) hypofluorite (CID 177034664) is (2-oxo-1H-pyridin-3-yl) hypofluorite.
What is the SMILES notation for (2-oxo-1H-pyridin-3-yl) hypofluorite?
The canonical SMILES for (2-oxo-1H-pyridin-3-yl) hypofluorite is O=c1[nH]cccc1OF.
What is the InChIKey of (2-oxo-1H-pyridin-3-yl) hypofluorite?
The InChIKey is PWVDMRBLPFRHBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4FNO2/c6-9-4-2-1-3-7-5(4)8/h1-3H,(H,7,8).
What are the key properties of (2-oxo-1H-pyridin-3-yl) hypofluorite?
(2-oxo-1H-pyridin-3-yl) hypofluorite has a molecular weight of 129.09 g/mol, XLogP of 0.64, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-1H-pyridin-3-yl) hypofluorite is sourced from PubChem (CID 177034664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).