C10H15N3O — CID 177034738
(3E,5E)-2-imino-7-methyl-3-(methylamino)octa-3,5,7-trienamide (PubChem CID 177034738) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is (3E,5E)-2-imino-7-methyl-3-(methylamino)octa-3,5,7-trienamide.
| Compound Name | (3E,5E)-2-imino-7-methyl-3-(methylamino)octa-3,5,7-trienamide |
|---|---|
| PubChem CID | 177034738 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | (3E,5E)-2-imino-7-methyl-3-(methylamino)octa-3,5,7-trienamide |
| SMILES | [H]/N=C(C(N)=O)/C(=C\C=C\C(=C)C)NC |
| InChI | InChI=1S/C10H15N3O/c1-7(2)5-4-6-8(13-3)9(11)10(12)14/h4-6,11,13H,1H2,2-3H3,(H2,12,14)/b5-4+,8-6+,11-9- |
| InChIKey | BYNCZXLTGVRUCH-HOZSQJEKSA-N |
| XLogP | 0.73 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|