About [(4-chlorothiophen-2-yl)-methylidene-oxo-λ6-sulfanyl]urea
[(4-chlorothiophen-2-yl)-methylidene-oxo-λ6-sulfanyl]urea (PubChem CID 177035502) has the molecular formula C6H7ClN2O2S2
and a molecular weight of 238.72 g/mol. Its IUPAC name is [(4-chlorothiophen-2-yl)-methylidene-oxo-λ6-sulfanyl]urea.
Molecular Properties
| Compound Name | [(4-chlorothiophen-2-yl)-methylidene-oxo-λ6-sulfanyl]urea |
| PubChem CID | 177035502 |
| Molecular Formula | C6H7ClN2O2S2 |
| Molecular Weight | 238.72 g/mol |
| Exact Mass | 237.96 |
| IUPAC Name | [(4-chlorothiophen-2-yl)-methylidene-oxo-λ6-sulfanyl]urea |
| SMILES | C=S(=O)(NC(N)=O)c1cc(Cl)cs1 |
| InChI | InChI=1S/C6H7ClN2O2S2/c1-13(11,9-6(8)10)5-2-4(7)3-12-5/h2-3H,1H2,(H3,8,9,10,11) |
| InChIKey | PLLIGGAEMVWKJW-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.72 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(4-chlorothiophen-2-yl)-methylidene-oxo-λ6-sulfanyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4-chlorothiophen-2-yl)-methylidene-oxo-λ6-sulfanyl]urea?
The IUPAC name of [(4-chlorothiophen-2-yl)-methylidene-oxo-λ6-sulfanyl]urea (CID 177035502) is [(4-chlorothiophen-2-yl)-methylidene-oxo-λ6-sulfanyl]urea.
What is the SMILES notation for [(4-chlorothiophen-2-yl)-methylidene-oxo-λ6-sulfanyl]urea?
The canonical SMILES for [(4-chlorothiophen-2-yl)-methylidene-oxo-λ6-sulfanyl]urea is C=S(=O)(NC(N)=O)c1cc(Cl)cs1.
What is the InChIKey of [(4-chlorothiophen-2-yl)-methylidene-oxo-λ6-sulfanyl]urea?
The InChIKey is PLLIGGAEMVWKJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClN2O2S2/c1-13(11,9-6(8)10)5-2-4(7)3-12-5/h2-3H,1H2,(H3,8,9,10,11).
What are the key properties of [(4-chlorothiophen-2-yl)-methylidene-oxo-λ6-sulfanyl]urea?
[(4-chlorothiophen-2-yl)-methylidene-oxo-λ6-sulfanyl]urea has a molecular weight of 238.72 g/mol, XLogP of 1.06, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(4-chlorothiophen-2-yl)-methylidene-oxo-λ6-sulfanyl]urea is sourced from PubChem (CID 177035502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).