About [3,5-bis(3,6-ditert-butylcarbazol-9-yl)phenyl]-pyridin-4-ylmethanone
[3,5-bis(3,6-ditert-butylcarbazol-9-yl)phenyl]-pyridin-4-ylmethanone (PubChem CID 177036009) has the molecular formula C52H55N3O
and a molecular weight of 738.03 g/mol. Its IUPAC name is [3,5-bis(3,6-ditert-butylcarbazol-9-yl)phenyl]-pyridin-4-ylmethanone.
Molecular Properties
| Compound Name | [3,5-bis(3,6-ditert-butylcarbazol-9-yl)phenyl]-pyridin-4-ylmethanone |
| PubChem CID | 177036009 |
| Molecular Formula | C52H55N3O |
| Molecular Weight | 738.03 g/mol |
| Exact Mass | 737.43 |
| IUPAC Name | [3,5-bis(3,6-ditert-butylcarbazol-9-yl)phenyl]-pyridin-4-ylmethanone |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1cc(C(=O)c2ccncc2)cc(-n2c3ccc(C(C)(C)C)cc3c3cc(C(C)(C)C)ccc32)c1 |
| InChI | InChI=1S/C52H55N3O/c1-49(2,3)34-13-17-44-40(27-34)41-28-35(50(4,5)6)14-18-45(41)54(44)38-25-33(48(56)32-21-23-53-24-22-32)26-39(31-38)55-46-19-15-36(51(7,8)9)29-42(46)43-30-37(52(10,11)12)16-20-47(43)55/h13-31H,1-12H3 |
| InChIKey | YNDRVHKTMOOPPW-UHFFFAOYSA-N |
| XLogP | 13.70 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 738.03 |
| LogP ≤ 5 | 13.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3,5-bis(3,6-ditert-butylcarbazol-9-yl)phenyl]-pyridin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-bis(3,6-ditert-butylcarbazol-9-yl)phenyl]-pyridin-4-ylmethanone?
The IUPAC name of [3,5-bis(3,6-ditert-butylcarbazol-9-yl)phenyl]-pyridin-4-ylmethanone (CID 177036009) is [3,5-bis(3,6-ditert-butylcarbazol-9-yl)phenyl]-pyridin-4-ylmethanone.
What is the SMILES notation for [3,5-bis(3,6-ditert-butylcarbazol-9-yl)phenyl]-pyridin-4-ylmethanone?
The canonical SMILES for [3,5-bis(3,6-ditert-butylcarbazol-9-yl)phenyl]-pyridin-4-ylmethanone is CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1cc(C(=O)c2ccncc2)cc(-n2c3ccc(C(C)(C)C)cc3c3cc(C(C)(C)C)ccc32)c1.
What is the InChIKey of [3,5-bis(3,6-ditert-butylcarbazol-9-yl)phenyl]-pyridin-4-ylmethanone?
The InChIKey is YNDRVHKTMOOPPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C52H55N3O/c1-49(2,3)34-13-17-44-40(27-34)41-28-35(50(4,5)6)14-18-45(41)54(44)38-25-33(48(56)32-21-23-53-24-22-32)26-39(31-38)55-46-19-15-36(51(7,8)9)29-42(46)43-30-37(52(10,11)12)16-20-47(43)55/h13-31H,1-12H3.
What are the key properties of [3,5-bis(3,6-ditert-butylcarbazol-9-yl)phenyl]-pyridin-4-ylmethanone?
[3,5-bis(3,6-ditert-butylcarbazol-9-yl)phenyl]-pyridin-4-ylmethanone has a molecular weight of 738.03 g/mol, XLogP of 13.70, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-bis(3,6-ditert-butylcarbazol-9-yl)phenyl]-pyridin-4-ylmethanone is sourced from PubChem (CID 177036009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).