C27H30F3N7O6S — CID 177036263
2-hydroxy-N-[(22Z)-26-(trifluoromethyl)-20,25,33-trioxa-1,9,10,15,17,32-hexazahexacyclo[24.2.2.18,11.112,16.117,21.02,7]tritriaconta-2(7),3,5,8,10,12(32),13,15,22-nonaen-4-yl]ethanesulfonamide (PubChem CID 177036263) has the molecular formula C27H30F3N7O6S and a molecular weight of 637.64 g/mol. Its IUPAC name is 2-hydroxy-N-[(22Z)-26-(trifluoromethyl)-20,25,33-trioxa-1,9,10,15,17,32-hexazahexacyclo[24.2.2.18,11.112,16.117,21.02,7]tritriaconta-2(7),3,5,8,10,12(32),13,15,22-nonaen-4-yl]ethanesulfonamide.
| Compound Name | 2-hydroxy-N-[(22Z)-26-(trifluoromethyl)-20,25,33-trioxa-1,9,10,15,17,32-hexazahexacyclo[24.2.2.18,11.112,16.117,21.02,7]tritriaconta-2(7),3,5,8,10,12(32),13,15,22-nonaen-4-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 177036263 |
| Molecular Formula | C27H30F3N7O6S |
| Molecular Weight | 637.64 g/mol |
| Exact Mass | 637.19 |
| IUPAC Name | 2-hydroxy-N-[(22Z)-26-(trifluoromethyl)-20,25,33-trioxa-1,9,10,15,17,32-hexazahexacyclo[24.2.2.18,11.112,16.117,21.02,7]tritriaconta-2(7),3,5,8,10,12(32),13,15,22-nonaen-4-yl]ethanesulfonamide |
| SMILES | O=S(=O)(CCO)Nc1ccc2c(c1)N1CCC(C(F)(F)F)(CC1)OC/C=C\C1CN(CCO1)c1nccc(n1)-c1nnc-2o1 |
| InChI | InChI=1S/C27H30F3N7O6S/c28-27(29,30)26-6-9-36(10-7-26)22-16-18(35-44(39,40)15-12-38)3-4-20(22)23-33-34-24(43-23)21-5-8-31-25(32-21)37-11-14-41-19(17-37)2-1-13-42-26/h1-5,8,16,19,35,38H,6-7,9-15,17H2/b2-1- |
| InChIKey | BQQBCLBFVUSSPG-UPHRSURJSA-N |
| XLogP | 2.62 |
| TPSA | 156.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.64 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|