C19H19N5O4S — CID 177036723
2-(1-benzofuran-2-yl)-N-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-8-yl)methyl]-1H-imidazole-5-sulfinamide (PubChem CID 177036723) has the molecular formula C19H19N5O4S and a molecular weight of 413.46 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-N-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-8-yl)methyl]-1H-imidazole-5-sulfinamide.
| Compound Name | 2-(1-benzofuran-2-yl)-N-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-8-yl)methyl]-1H-imidazole-5-sulfinamide |
|---|---|
| PubChem CID | 177036723 |
| Molecular Formula | C19H19N5O4S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-N-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-8-yl)methyl]-1H-imidazole-5-sulfinamide |
| SMILES | O=C1NC(=O)C2(CCC(CNS(=O)c3cnc(-c4cc5ccccc5o4)[nH]3)C2)N1 |
| InChI | InChI=1S/C19H19N5O4S/c25-17-19(24-18(26)23-17)6-5-11(8-19)9-21-29(27)15-10-20-16(22-15)14-7-12-3-1-2-4-13(12)28-14/h1-4,7,10-11,21H,5-6,8-9H2,(H,20,22)(H2,23,24,25,26) |
| InChIKey | UUVPJYARCVUKIO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 129.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|