C14H14F3N3O3S — CID 177036749
N-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl)methyl]-2,3,4-trifluorobenzenesulfinamide (PubChem CID 177036749) has the molecular formula C14H14F3N3O3S and a molecular weight of 361.35 g/mol. Its IUPAC name is N-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl)methyl]-2,3,4-trifluorobenzenesulfinamide.
| Compound Name | N-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl)methyl]-2,3,4-trifluorobenzenesulfinamide |
|---|---|
| PubChem CID | 177036749 |
| Molecular Formula | C14H14F3N3O3S |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | N-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl)methyl]-2,3,4-trifluorobenzenesulfinamide |
| SMILES | O=C1NC(=O)C2(CCCC2CNS(=O)c2ccc(F)c(F)c2F)N1 |
| InChI | InChI=1S/C14H14F3N3O3S/c15-8-3-4-9(11(17)10(8)16)24(23)18-6-7-2-1-5-14(7)12(21)19-13(22)20-14/h3-4,7,18H,1-2,5-6H2,(H2,19,20,21,22) |
| InChIKey | UDRKZJWCCIXEKN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|