C14H17ClN4O4S — CID 177036785
6-chloro-N-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl)methyl]-2-methylpyridine-3-sulfonamide (PubChem CID 177036785) has the molecular formula C14H17ClN4O4S and a molecular weight of 372.83 g/mol. Its IUPAC name is 6-chloro-N-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl)methyl]-2-methylpyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl)methyl]-2-methylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 177036785 |
| Molecular Formula | C14H17ClN4O4S |
| Molecular Weight | 372.83 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 6-chloro-N-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl)methyl]-2-methylpyridine-3-sulfonamide |
| SMILES | Cc1nc(Cl)ccc1S(=O)(=O)NCC1CCCC12NC(=O)NC2=O |
| InChI | InChI=1S/C14H17ClN4O4S/c1-8-10(4-5-11(15)17-8)24(22,23)16-7-9-3-2-6-14(9)12(20)18-13(21)19-14/h4-5,9,16H,2-3,6-7H2,1H3,(H2,18,19,20,21) |
| InChIKey | MUWGQHANRKGDRZ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.83 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|