About butane;ethane;6-methylimidazo[1,5-a]pyrazine
butane;ethane;6-methylimidazo[1,5-a]pyrazine (PubChem CID 177037268) has the molecular formula C13H23N3
and a molecular weight of 221.35 g/mol. Its IUPAC name is butane;ethane;6-methylimidazo[1,5-a]pyrazine.
Molecular Properties
| Compound Name | butane;ethane;6-methylimidazo[1,5-a]pyrazine |
| PubChem CID | 177037268 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | butane;ethane;6-methylimidazo[1,5-a]pyrazine |
| SMILES | CC.CCCC.Cc1cn2cncc2cn1 |
| InChI | InChI=1S/C7H7N3.C4H10.C2H6/c1-6-4-10-5-8-2-7(10)3-9-6;1-3-4-2;1-2/h2-5H,1H3;3-4H2,1-2H3;1-2H3 |
| InChIKey | FBECLJGHENVLOD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze butane;ethane;6-methylimidazo[1,5-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;ethane;6-methylimidazo[1,5-a]pyrazine?
The IUPAC name of butane;ethane;6-methylimidazo[1,5-a]pyrazine (CID 177037268) is butane;ethane;6-methylimidazo[1,5-a]pyrazine.
What is the SMILES notation for butane;ethane;6-methylimidazo[1,5-a]pyrazine?
The canonical SMILES for butane;ethane;6-methylimidazo[1,5-a]pyrazine is CC.CCCC.Cc1cn2cncc2cn1.
What is the InChIKey of butane;ethane;6-methylimidazo[1,5-a]pyrazine?
The InChIKey is FBECLJGHENVLOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3.C4H10.C2H6/c1-6-4-10-5-8-2-7(10)3-9-6;1-3-4-2;1-2/h2-5H,1H3;3-4H2,1-2H3;1-2H3.
What are the key properties of butane;ethane;6-methylimidazo[1,5-a]pyrazine?
butane;ethane;6-methylimidazo[1,5-a]pyrazine has a molecular weight of 221.35 g/mol, XLogP of 3.87, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butane;ethane;6-methylimidazo[1,5-a]pyrazine is sourced from PubChem (CID 177037268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).