About ethane;6-ethylimidazo[1,5-a]pyrazine
ethane;6-ethylimidazo[1,5-a]pyrazine (PubChem CID 177037522) has the molecular formula C10H15N3
and a molecular weight of 177.25 g/mol. Its IUPAC name is ethane;6-ethylimidazo[1,5-a]pyrazine.
Molecular Properties
| Compound Name | ethane;6-ethylimidazo[1,5-a]pyrazine |
| PubChem CID | 177037522 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | ethane;6-ethylimidazo[1,5-a]pyrazine |
| SMILES | CC.CCc1cn2cncc2cn1 |
| InChI | InChI=1S/C8H9N3.C2H6/c1-2-7-5-11-6-9-3-8(11)4-10-7;1-2/h3-6H,2H2,1H3;1-2H3 |
| InChIKey | GERXWSBZUBRPMF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;6-ethylimidazo[1,5-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-ethylimidazo[1,5-a]pyrazine?
The IUPAC name of ethane;6-ethylimidazo[1,5-a]pyrazine (CID 177037522) is ethane;6-ethylimidazo[1,5-a]pyrazine.
What is the SMILES notation for ethane;6-ethylimidazo[1,5-a]pyrazine?
The canonical SMILES for ethane;6-ethylimidazo[1,5-a]pyrazine is CC.CCc1cn2cncc2cn1.
What is the InChIKey of ethane;6-ethylimidazo[1,5-a]pyrazine?
The InChIKey is GERXWSBZUBRPMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3.C2H6/c1-2-7-5-11-6-9-3-8(11)4-10-7;1-2/h3-6H,2H2,1H3;1-2H3.
What are the key properties of ethane;6-ethylimidazo[1,5-a]pyrazine?
ethane;6-ethylimidazo[1,5-a]pyrazine has a molecular weight of 177.25 g/mol, XLogP of 2.32, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-ethylimidazo[1,5-a]pyrazine is sourced from PubChem (CID 177037522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).