About 7,8-bis(ethenyl)-4-azaspiro[2.5]oct-7-en-4-amine;ethane
7,8-bis(ethenyl)-4-azaspiro[2.5]oct-7-en-4-amine;ethane (PubChem CID 177037789) has the molecular formula C13H22N2
and a molecular weight of 206.33 g/mol. Its IUPAC name is 7,8-bis(ethenyl)-4-azaspiro[2.5]oct-7-en-4-amine;ethane.
Molecular Properties
| Compound Name | 7,8-bis(ethenyl)-4-azaspiro[2.5]oct-7-en-4-amine;ethane |
| PubChem CID | 177037789 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 7,8-bis(ethenyl)-4-azaspiro[2.5]oct-7-en-4-amine;ethane |
| SMILES | C=CC1=C(C=C)C2(CC2)N(N)CC1.CC |
| InChI | InChI=1S/C11H16N2.C2H6/c1-3-9-5-8-13(12)11(6-7-11)10(9)4-2;1-2/h3-4H,1-2,5-8,12H2;1-2H3 |
| InChIKey | HBNPVHQZBZIVGM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 7,8-bis(ethenyl)-4-azaspiro[2.5]oct-7-en-4-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-bis(ethenyl)-4-azaspiro[2.5]oct-7-en-4-amine;ethane?
The IUPAC name of 7,8-bis(ethenyl)-4-azaspiro[2.5]oct-7-en-4-amine;ethane (CID 177037789) is 7,8-bis(ethenyl)-4-azaspiro[2.5]oct-7-en-4-amine;ethane.
What is the SMILES notation for 7,8-bis(ethenyl)-4-azaspiro[2.5]oct-7-en-4-amine;ethane?
The canonical SMILES for 7,8-bis(ethenyl)-4-azaspiro[2.5]oct-7-en-4-amine;ethane is C=CC1=C(C=C)C2(CC2)N(N)CC1.CC.
What is the InChIKey of 7,8-bis(ethenyl)-4-azaspiro[2.5]oct-7-en-4-amine;ethane?
The InChIKey is HBNPVHQZBZIVGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2.C2H6/c1-3-9-5-8-13(12)11(6-7-11)10(9)4-2;1-2/h3-4H,1-2,5-8,12H2;1-2H3.
What are the key properties of 7,8-bis(ethenyl)-4-azaspiro[2.5]oct-7-en-4-amine;ethane?
7,8-bis(ethenyl)-4-azaspiro[2.5]oct-7-en-4-amine;ethane has a molecular weight of 206.33 g/mol, XLogP of 2.79, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-bis(ethenyl)-4-azaspiro[2.5]oct-7-en-4-amine;ethane is sourced from PubChem (CID 177037789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).