About 5-ethyl-2,7-dimethyl-3H-azepine;N-methylacetamide
5-ethyl-2,7-dimethyl-3H-azepine;N-methylacetamide (PubChem CID 177038243) has the molecular formula C13H22N2O
and a molecular weight of 222.33 g/mol. Its IUPAC name is 5-ethyl-2,7-dimethyl-3H-azepine;N-methylacetamide.
Molecular Properties
| Compound Name | 5-ethyl-2,7-dimethyl-3H-azepine;N-methylacetamide |
| PubChem CID | 177038243 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 5-ethyl-2,7-dimethyl-3H-azepine;N-methylacetamide |
| SMILES | CCC1=CCC(C)=NC(C)=C1.CNC(C)=O |
| InChI | InChI=1S/C10H15N.C3H7NO/c1-4-10-6-5-8(2)11-9(3)7-10;1-3(5)4-2/h6-7H,4-5H2,1-3H3;1-2H3,(H,4,5) |
| InChIKey | CMTSPUUBXIVLIS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethyl-2,7-dimethyl-3H-azepine;N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2,7-dimethyl-3H-azepine;N-methylacetamide?
The IUPAC name of 5-ethyl-2,7-dimethyl-3H-azepine;N-methylacetamide (CID 177038243) is 5-ethyl-2,7-dimethyl-3H-azepine;N-methylacetamide.
What is the SMILES notation for 5-ethyl-2,7-dimethyl-3H-azepine;N-methylacetamide?
The canonical SMILES for 5-ethyl-2,7-dimethyl-3H-azepine;N-methylacetamide is CCC1=CCC(C)=NC(C)=C1.CNC(C)=O.
What is the InChIKey of 5-ethyl-2,7-dimethyl-3H-azepine;N-methylacetamide?
The InChIKey is CMTSPUUBXIVLIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N.C3H7NO/c1-4-10-6-5-8(2)11-9(3)7-10;1-3(5)4-2/h6-7H,4-5H2,1-3H3;1-2H3,(H,4,5).
What are the key properties of 5-ethyl-2,7-dimethyl-3H-azepine;N-methylacetamide?
5-ethyl-2,7-dimethyl-3H-azepine;N-methylacetamide has a molecular weight of 222.33 g/mol, XLogP of 2.84, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2,7-dimethyl-3H-azepine;N-methylacetamide is sourced from PubChem (CID 177038243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).