C21H27N7O — CID 177038472
6-(2-cyclopropyl-8-methoxyimidazo[1,2-a]pyridin-6-yl)-2,8-dimethyl-[1,2,4]triazolo[1,5-b]pyridazine;N,N-dimethylmethanamine (PubChem CID 177038472) has the molecular formula C21H27N7O and a molecular weight of 393.50 g/mol. Its IUPAC name is 6-(2-cyclopropyl-8-methoxyimidazo[1,2-a]pyridin-6-yl)-2,8-dimethyl-[1,2,4]triazolo[1,5-b]pyridazine;N,N-dimethylmethanamine.
| Compound Name | 6-(2-cyclopropyl-8-methoxyimidazo[1,2-a]pyridin-6-yl)-2,8-dimethyl-[1,2,4]triazolo[1,5-b]pyridazine;N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 177038472 |
| Molecular Formula | C21H27N7O |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 6-(2-cyclopropyl-8-methoxyimidazo[1,2-a]pyridin-6-yl)-2,8-dimethyl-[1,2,4]triazolo[1,5-b]pyridazine;N,N-dimethylmethanamine |
| SMILES | CN(C)C.COc1cc(-c2cc(C)c3nc(C)nn3n2)cn2cc(C3CC3)nc12 |
| InChI | InChI=1S/C18H18N6O.C3H9N/c1-10-6-14(22-24-17(10)19-11(2)21-24)13-7-16(25-3)18-20-15(12-4-5-12)9-23(18)8-13;1-4(2)3/h6-9,12H,4-5H2,1-3H3;1-3H3 |
| InChIKey | VDTCJJGFHOSAIF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 72.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |