C21H24N4O3S — CID 177039533
10-(benzenesulfonyl)-3-cyclopentyl-5-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one;methane (PubChem CID 177039533) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is 10-(benzenesulfonyl)-3-cyclopentyl-5-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one;methane.
| Compound Name | 10-(benzenesulfonyl)-3-cyclopentyl-5-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one;methane |
|---|---|
| PubChem CID | 177039533 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 10-(benzenesulfonyl)-3-cyclopentyl-5-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one;methane |
| SMILES | C.Cn1c(=O)n(C2CCCC2)c2c3ccn(S(=O)(=O)c4ccccc4)c3ncc21 |
| InChI | InChI=1S/C20H20N4O3S.CH4/c1-22-17-13-21-19-16(18(17)24(20(22)25)14-7-5-6-8-14)11-12-23(19)28(26,27)15-9-3-2-4-10-15;/h2-4,9-14H,5-8H2,1H3;1H4 |
| InChIKey | UKFUIFOBGCRFTG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 78.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |